C13H8Cl2F3N — CID 107572844
3,5-dichloro-N-[(2,4-difluorophenyl)methyl]-4-fluoroaniline (PubChem CID 107572844) has the molecular formula C13H8Cl2F3N and a molecular weight of 306.11 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2,4-difluorophenyl)methyl]-4-fluoroaniline.
| Compound Name | 3,5-dichloro-N-[(2,4-difluorophenyl)methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 107572844 |
| Molecular Formula | C13H8Cl2F3N |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 3,5-dichloro-N-[(2,4-difluorophenyl)methyl]-4-fluoroaniline |
| SMILES | Fc1ccc(CNc2cc(Cl)c(F)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C13H8Cl2F3N/c14-10-4-9(5-11(15)13(10)18)19-6-7-1-2-8(16)3-12(7)17/h1-5,19H,6H2 |
| InChIKey | KOIDSMYPBGBJEX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|