About 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine
2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine (PubChem CID 107573287) has the molecular formula C14H23BrN2O
and a molecular weight of 315.26 g/mol. Its IUPAC name is 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine |
| PubChem CID | 107573287 |
| Molecular Formula | C14H23BrN2O |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine |
| SMILES | CCC(CN)(COC)Nc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C14H23BrN2O/c1-5-14(8-16,9-18-4)17-12-6-10(2)13(15)11(3)7-12/h6-7,17H,5,8-9,16H2,1-4H3 |
| InChIKey | WTNFSFUCNOZUNF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine?
The IUPAC name of 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine (CID 107573287) is 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine.
What is the SMILES notation for 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine?
The canonical SMILES for 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine is CCC(CN)(COC)Nc1cc(C)c(Br)c(C)c1.
What is the InChIKey of 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine?
The InChIKey is WTNFSFUCNOZUNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23BrN2O/c1-5-14(8-16,9-18-4)17-12-6-10(2)13(15)11(3)7-12/h6-7,17H,5,8-9,16H2,1-4H3.
What are the key properties of 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine?
2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine has a molecular weight of 315.26 g/mol, XLogP of 3.23, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-bromo-3,5-dimethylphenyl)-2-(methoxymethyl)butane-1,2-diamine is sourced from PubChem (CID 107573287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).