C11H5BrCl3FN2O2S — CID 107573401
5-bromo-2-chloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-3-sulfonamide (PubChem CID 107573401) has the molecular formula C11H5BrCl3FN2O2S and a molecular weight of 434.50 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107573401 |
| Molecular Formula | C11H5BrCl3FN2O2S |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 431.83 |
| IUPAC Name | 5-bromo-2-chloro-N-(3,5-dichloro-4-fluorophenyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(F)c(Cl)c1)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C11H5BrCl3FN2O2S/c12-5-1-9(11(15)17-4-5)21(19,20)18-6-2-7(13)10(16)8(14)3-6/h1-4,18H |
| InChIKey | ZAYYZIWFOCEOHG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|