C16H18BrNO — CID 107573411
4-bromo-3,5-dimethyl-N-(2-phenoxyethyl)aniline (PubChem CID 107573411) has the molecular formula C16H18BrNO and a molecular weight of 320.23 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-N-(2-phenoxyethyl)aniline.
| Compound Name | 4-bromo-3,5-dimethyl-N-(2-phenoxyethyl)aniline |
|---|---|
| PubChem CID | 107573411 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-bromo-3,5-dimethyl-N-(2-phenoxyethyl)aniline |
| SMILES | Cc1cc(NCCOc2ccccc2)cc(C)c1Br |
| InChI | InChI=1S/C16H18BrNO/c1-12-10-14(11-13(2)16(12)17)18-8-9-19-15-6-4-3-5-7-15/h3-7,10-11,18H,8-9H2,1-2H3 |
| InChIKey | QZDDHNMHANEYBY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|