C17H24BrNO — CID 107573556
4-bromo-3,5-dimethyl-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)aniline (PubChem CID 107573556) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)aniline.
| Compound Name | 4-bromo-3,5-dimethyl-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 107573556 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-bromo-3,5-dimethyl-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)aniline |
| SMILES | Cc1cc(NCC2CCC3(CCCC3)O2)cc(C)c1Br |
| InChI | InChI=1S/C17H24BrNO/c1-12-9-14(10-13(2)16(12)18)19-11-15-5-8-17(20-15)6-3-4-7-17/h9-10,15,19H,3-8,11H2,1-2H3 |
| InChIKey | VVHKDGOYDWIORR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |