C11H10Cl2FN3O2S — CID 107574082
1-(3,5-dichloro-4-fluoroanilino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol (PubChem CID 107574082) has the molecular formula C11H10Cl2FN3O2S and a molecular weight of 338.19 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-fluoroanilino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol.
| Compound Name | 1-(3,5-dichloro-4-fluoroanilino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 107574082 |
| Molecular Formula | C11H10Cl2FN3O2S |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 1-(3,5-dichloro-4-fluoroanilino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
| SMILES | OC(CNc1cc(Cl)c(F)c(Cl)c1)COc1cnsn1 |
| InChI | InChI=1S/C11H10Cl2FN3O2S/c12-8-1-6(2-9(13)11(8)14)15-3-7(18)5-19-10-4-16-20-17-10/h1-2,4,7,15,18H,3,5H2 |
| InChIKey | FZTZBBJNJLLCEQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|