C12H17BrN2O — CID 107574214
N-(4-bromo-3,5-dimethylphenyl)-2-(methylamino)propanamide (PubChem CID 107574214) has the molecular formula C12H17BrN2O and a molecular weight of 285.19 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-2-(methylamino)propanamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 107574214 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)Nc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C12H17BrN2O/c1-7-5-10(6-8(2)11(7)13)15-12(16)9(3)14-4/h5-6,9,14H,1-4H3,(H,15,16) |
| InChIKey | ZJXUZDDOWFZHDC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |