About methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate
methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate (PubChem CID 107574623) has the molecular formula C11H12BrN3S
and a molecular weight of 298.21 g/mol. Its IUPAC name is methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate |
| PubChem CID | 107574623 |
| Molecular Formula | C11H12BrN3S |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cc(C)c(Br)c(C)c1)NC#N |
| InChI | InChI=1S/C11H12BrN3S/c1-7-4-9(5-8(2)10(7)12)15-11(16-3)14-6-13/h4-5H,1-3H3,(H,14,15) |
| InChIKey | FQGZXFVJHDRQOC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate?
The IUPAC name of methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate (CID 107574623) is methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate.
What is the SMILES notation for methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate?
The canonical SMILES for methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate is CS/C(=N\c1cc(C)c(Br)c(C)c1)NC#N.
What is the InChIKey of methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate?
The InChIKey is FQGZXFVJHDRQOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrN3S/c1-7-4-9(5-8(2)10(7)12)15-11(16-3)14-6-13/h4-5H,1-3H3,(H,14,15).
What are the key properties of methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate?
methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate has a molecular weight of 298.21 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-(4-bromo-3,5-dimethylphenyl)-N-cyanocarbamimidothioate is sourced from PubChem (CID 107574623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).