About N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine
N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine (PubChem CID 10757515) has the molecular formula C20H28N2O
and a molecular weight of 312.46 g/mol. Its IUPAC name is N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine |
| PubChem CID | 10757515 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine |
| SMILES | CC(C)(CN)CNCCOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28N2O/c1-20(2,15-21)16-22-13-14-23-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19,22H,13-16,21H2,1-2H3 |
| InChIKey | AUSBQGUOSUIIQF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine?
The IUPAC name of N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine (CID 10757515) is N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine.
What is the SMILES notation for N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine?
The canonical SMILES for N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine is CC(C)(CN)CNCCOC(c1ccccc1)c1ccccc1.
What is the InChIKey of N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine?
The InChIKey is AUSBQGUOSUIIQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O/c1-20(2,15-21)16-22-13-14-23-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19,22H,13-16,21H2,1-2H3.
What are the key properties of N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine?
N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine has a molecular weight of 312.46 g/mol, XLogP of 3.37, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-benzhydryloxyethyl)-2,2-dimethylpropane-1,3-diamine is sourced from PubChem (CID 10757515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).