About 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine
1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine (PubChem CID 107575237) has the molecular formula C14H20BrN
and a molecular weight of 282.22 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine.
Molecular Properties
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine |
| PubChem CID | 107575237 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine |
| SMILES | CCCC1CN(c2cc(C)c(Br)c(C)c2)C1 |
| InChI | InChI=1S/C14H20BrN/c1-4-5-12-8-16(9-12)13-6-10(2)14(15)11(3)7-13/h6-7,12H,4-5,8-9H2,1-3H3 |
| InChIKey | GPNVYNDZVKEEML-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine?
The IUPAC name of 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine (CID 107575237) is 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine.
What is the SMILES notation for 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine?
The canonical SMILES for 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine is CCCC1CN(c2cc(C)c(Br)c(C)c2)C1.
What is the InChIKey of 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine?
The InChIKey is GPNVYNDZVKEEML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrN/c1-4-5-12-8-16(9-12)13-6-10(2)14(15)11(3)7-13/h6-7,12H,4-5,8-9H2,1-3H3.
What are the key properties of 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine?
1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine has a molecular weight of 282.22 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-3,5-dimethylphenyl)-3-propylazetidine is sourced from PubChem (CID 107575237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).