C16H15BrN2S — CID 107575757
3-(4-bromo-3,5-dimethylphenyl)-5-methyl-1H-benzimidazole-2-thione (PubChem CID 107575757) has the molecular formula C16H15BrN2S and a molecular weight of 347.28 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenyl)-5-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-(4-bromo-3,5-dimethylphenyl)-5-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107575757 |
| Molecular Formula | C16H15BrN2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenyl)-5-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)n(-c3cc(C)c(Br)c(C)c3)c2c1 |
| InChI | InChI=1S/C16H15BrN2S/c1-9-4-5-13-14(6-9)19(16(20)18-13)12-7-10(2)15(17)11(3)8-12/h4-8H,1-3H3,(H,18,20) |
| InChIKey | GZNDBUYODREJTB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|