C13H7Cl3FN3 — CID 107575892
7-chloro-1-(3,5-dichloro-4-fluorophenyl)benzimidazol-2-amine (PubChem CID 107575892) has the molecular formula C13H7Cl3FN3 and a molecular weight of 330.58 g/mol. Its IUPAC name is 7-chloro-1-(3,5-dichloro-4-fluorophenyl)benzimidazol-2-amine.
| Compound Name | 7-chloro-1-(3,5-dichloro-4-fluorophenyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 107575892 |
| Molecular Formula | C13H7Cl3FN3 |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 7-chloro-1-(3,5-dichloro-4-fluorophenyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cccc(Cl)c2n1-c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C13H7Cl3FN3/c14-7-2-1-3-10-12(7)20(13(18)19-10)6-4-8(15)11(17)9(16)5-6/h1-5H,(H2,18,19) |
| InChIKey | XEUZVEDQSIPTRN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|