C16H26O6 — CID 10757635
(1R,2S,7S,11E,13S,15S)-2,3,4,15-tetrahydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one (PubChem CID 10757635) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1R,2S,7S,11E,13S,15S)-2,3,4,15-tetrahydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one.
| Compound Name | (1R,2S,7S,11E,13S,15S)-2,3,4,15-tetrahydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
|---|---|
| PubChem CID | 10757635 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1R,2S,7S,11E,13S,15S)-2,3,4,15-tetrahydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](O)C(O)C(O)C(=O)O1 |
| InChI | InChI=1S/C16H26O6/c1-9-5-3-2-4-6-10-7-11(17)8-12(10)13(18)14(19)15(20)16(21)22-9/h4,6,9-15,17-20H,2-3,5,7-8H2,1H3/b6-4+/t9-,10+,11-,12+,13-,14?,15?/m0/s1 |
| InChIKey | ZACUXJNBMSDSMR-LQZAQQFOSA-N |
| XLogP | 0.13 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|