About 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid
2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid (PubChem CID 10757760) has the molecular formula C16H16N2O5
and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid |
| PubChem CID | 10757760 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid |
| SMILES | COc1cc2c(cc1OC)-c1nn(CC(=O)O)c(=O)cc1CC2 |
| InChI | InChI=1S/C16H16N2O5/c1-22-12-5-9-3-4-10-6-14(19)18(8-15(20)21)17-16(10)11(9)7-13(12)23-2/h5-7H,3-4,8H2,1-2H3,(H,20,21) |
| InChIKey | QQCVAGNAVPCWPM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid?
The IUPAC name of 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid (CID 10757760) is 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid.
What is the SMILES notation for 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid?
The canonical SMILES for 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid is COc1cc2c(cc1OC)-c1nn(CC(=O)O)c(=O)cc1CC2.
What is the InChIKey of 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid?
The InChIKey is QQCVAGNAVPCWPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O5/c1-22-12-5-9-3-4-10-6-14(19)18(8-15(20)21)17-16(10)11(9)7-13(12)23-2/h5-7H,3-4,8H2,1-2H3,(H,20,21).
What are the key properties of 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid?
2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid has a molecular weight of 316.31 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8,9-dimethoxy-3-oxo-5,6-dihydrobenzo[h]cinnolin-2-yl)acetic acid is sourced from PubChem (CID 10757760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).