C20H28O3 — CID 10757801
(8R,9S,13S,14S,17S)-6-ethyl-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,6,17-triol (PubChem CID 10757801) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-6-ethyl-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,6,17-triol.
| Compound Name | (8R,9S,13S,14S,17S)-6-ethyl-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,6,17-triol |
|---|---|
| PubChem CID | 10757801 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (8R,9S,13S,14S,17S)-6-ethyl-13-methyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthrene-3,6,17-triol |
| SMILES | CCC1(O)C[C@@H]2[C@H](CC[C@]3(C)[C@@H](O)CC[C@@H]23)c2ccc(O)cc21 |
| InChI | InChI=1S/C20H28O3/c1-3-20(23)11-15-13(14-5-4-12(21)10-17(14)20)8-9-19(2)16(15)6-7-18(19)22/h4-5,10,13,15-16,18,21-23H,3,6-9,11H2,1-2H3/t13-,15-,16+,18+,19+,20?/m1/s1 |
| InChIKey | SVRNDVIAXKHEIJ-LNVABPHUSA-N |
| XLogP | 3.66 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |