C16H17BrN2O — CID 107578496
N-(3-bromo-5-methylphenyl)-5-methyl-2-(methylamino)benzamide (PubChem CID 107578496) has the molecular formula C16H17BrN2O and a molecular weight of 333.23 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-5-methyl-2-(methylamino)benzamide.
| Compound Name | N-(3-bromo-5-methylphenyl)-5-methyl-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 107578496 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-5-methyl-2-(methylamino)benzamide |
| SMILES | CNc1ccc(C)cc1C(=O)Nc1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C16H17BrN2O/c1-10-4-5-15(18-3)14(8-10)16(20)19-13-7-11(2)6-12(17)9-13/h4-9,18H,1-3H3,(H,19,20) |
| InChIKey | XIJMQZXCRZZEIM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |