About (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine
(6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine (PubChem CID 107579034) has the molecular formula C14H16BrN3
and a molecular weight of 306.21 g/mol. Its IUPAC name is (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine |
| PubChem CID | 107579034 |
| Molecular Formula | C14H16BrN3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine |
| SMILES | Cc1cc2nc(C3CC3)cc(NN)c2c(C)c1Br |
| InChI | InChI=1S/C14H16BrN3/c1-7-5-11-13(8(2)14(7)15)12(18-16)6-10(17-11)9-3-4-9/h5-6,9H,3-4,16H2,1-2H3,(H,17,18) |
| InChIKey | HJRTYNIABNBRIU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine?
The IUPAC name of (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine (CID 107579034) is (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine.
What is the SMILES notation for (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine?
The canonical SMILES for (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine is Cc1cc2nc(C3CC3)cc(NN)c2c(C)c1Br.
What is the InChIKey of (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine?
The InChIKey is HJRTYNIABNBRIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrN3/c1-7-5-11-13(8(2)14(7)15)12(18-16)6-10(17-11)9-3-4-9/h5-6,9H,3-4,16H2,1-2H3,(H,17,18).
What are the key properties of (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine?
(6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine has a molecular weight of 306.21 g/mol, XLogP of 3.78, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2-cyclopropyl-5,7-dimethylquinolin-4-yl)hydrazine is sourced from PubChem (CID 107579034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).