C16H22N4O3 — CID 10757912
(4aS,5R,6R,7R)-6-azido-2-benzyl-7-methyl-1,3,4,5,6,7a-hexahydrocyclopenta[c]pyridine-4a,5,7-triol (PubChem CID 10757912) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is (4aS,5R,6R,7R)-6-azido-2-benzyl-7-methyl-1,3,4,5,6,7a-hexahydrocyclopenta[c]pyridine-4a,5,7-triol.
| Compound Name | (4aS,5R,6R,7R)-6-azido-2-benzyl-7-methyl-1,3,4,5,6,7a-hexahydrocyclopenta[c]pyridine-4a,5,7-triol |
|---|---|
| PubChem CID | 10757912 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (4aS,5R,6R,7R)-6-azido-2-benzyl-7-methyl-1,3,4,5,6,7a-hexahydrocyclopenta[c]pyridine-4a,5,7-triol |
| SMILES | C[C@@]1(O)C2CN(Cc3ccccc3)CC[C@@]2(O)[C@H](O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C16H22N4O3/c1-15(22)12-10-20(9-11-5-3-2-4-6-11)8-7-16(12,23)14(21)13(15)18-19-17/h2-6,12-14,21-23H,7-10H2,1H3/t12?,13-,14-,15-,16+/m1/s1 |
| InChIKey | AROMFVWJKSLYGM-ZOSGLXAKSA-N |
| XLogP | 1.04 |
| TPSA | 112.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|