C10H12BrN5 — CID 107579309
[1-(4-bromo-3,5-dimethylphenyl)tetrazol-5-yl]methanamine (PubChem CID 107579309) has the molecular formula C10H12BrN5 and a molecular weight of 282.15 g/mol. Its IUPAC name is [1-(4-bromo-3,5-dimethylphenyl)tetrazol-5-yl]methanamine.
| Compound Name | [1-(4-bromo-3,5-dimethylphenyl)tetrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 107579309 |
| Molecular Formula | C10H12BrN5 |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | [1-(4-bromo-3,5-dimethylphenyl)tetrazol-5-yl]methanamine |
| SMILES | Cc1cc(-n2nnnc2CN)cc(C)c1Br |
| InChI | InChI=1S/C10H12BrN5/c1-6-3-8(4-7(2)10(6)11)16-9(5-12)13-14-15-16/h3-4H,5,12H2,1-2H3 |
| InChIKey | NJOOQWXNIHIZKC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |