C12H11Cl2FN2O2 — CID 107580201
1-(3,5-dichloro-4-fluorophenyl)-3,3-dimethylpiperazine-2,5-dione (PubChem CID 107580201) has the molecular formula C12H11Cl2FN2O2 and a molecular weight of 305.14 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-fluorophenyl)-3,3-dimethylpiperazine-2,5-dione.
| Compound Name | 1-(3,5-dichloro-4-fluorophenyl)-3,3-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107580201 |
| Molecular Formula | C12H11Cl2FN2O2 |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 1-(3,5-dichloro-4-fluorophenyl)-3,3-dimethylpiperazine-2,5-dione |
| SMILES | CC1(C)NC(=O)CN(c2cc(Cl)c(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C12H11Cl2FN2O2/c1-12(2)11(19)17(5-9(18)16-12)6-3-7(13)10(15)8(14)4-6/h3-4H,5H2,1-2H3,(H,16,18) |
| InChIKey | XSFUNFCLKOWQTJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|