About 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole
3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole (PubChem CID 10758096) has the molecular formula C19H13ClN2O
and a molecular weight of 320.78 g/mol. Its IUPAC name is 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole.
Molecular Properties
| Compound Name | 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole |
| PubChem CID | 10758096 |
| Molecular Formula | C19H13ClN2O |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole |
| SMILES | COc1ccc2[nH]c3c(ccc4c5cc(Cl)ccc5[nH]c43)c2c1 |
| InChI | InChI=1S/C19H13ClN2O/c1-23-11-3-7-17-15(9-11)13-5-4-12-14-8-10(20)2-6-16(14)21-18(12)19(13)22-17/h2-9,21-22H,1H3 |
| InChIKey | WCLJEEUUKWIFMF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole?
The IUPAC name of 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole (CID 10758096) is 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole.
What is the SMILES notation for 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole?
The canonical SMILES for 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole is COc1ccc2[nH]c3c(ccc4c5cc(Cl)ccc5[nH]c43)c2c1.
What is the InChIKey of 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole?
The InChIKey is WCLJEEUUKWIFMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClN2O/c1-23-11-3-7-17-15(9-11)13-5-4-12-14-8-10(20)2-6-16(14)21-18(12)19(13)22-17/h2-9,21-22H,1H3.
What are the key properties of 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole?
3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole has a molecular weight of 320.78 g/mol, XLogP of 5.62, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-8-methoxy-11,12-dihydroindolo[2,3-a]carbazole is sourced from PubChem (CID 10758096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).