C11H11Cl2FN4O — CID 107581548
N-(3,5-dichloro-4-fluorophenyl)-5-(ethylaminomethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 107581548) has the molecular formula C11H11Cl2FN4O and a molecular weight of 305.14 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-5-(ethylaminomethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-5-(ethylaminomethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 107581548 |
| Molecular Formula | C11H11Cl2FN4O |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-5-(ethylaminomethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CCNCc1nnc(Nc2cc(Cl)c(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C11H11Cl2FN4O/c1-2-15-5-9-17-18-11(19-9)16-6-3-7(12)10(14)8(13)4-6/h3-4,15H,2,5H2,1H3,(H,16,18) |
| InChIKey | UIOANEGOVWFTPP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|