C11H15BrO4S — CID 10758232
[(1R,2S,6S,7S,8S,9R)-9-bromo-4,4-dioxo-4λ6-thiatricyclo[5.2.1.02,6]decan-8-yl] acetate (PubChem CID 10758232) has the molecular formula C11H15BrO4S and a molecular weight of 323.21 g/mol. Its IUPAC name is [(1R,2S,6S,7S,8S,9R)-9-bromo-4,4-dioxo-4λ6-thiatricyclo[5.2.1.02,6]decan-8-yl] acetate.
| Compound Name | [(1R,2S,6S,7S,8S,9R)-9-bromo-4,4-dioxo-4λ6-thiatricyclo[5.2.1.02,6]decan-8-yl] acetate |
|---|---|
| PubChem CID | 10758232 |
| Molecular Formula | C11H15BrO4S |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | [(1R,2S,6S,7S,8S,9R)-9-bromo-4,4-dioxo-4λ6-thiatricyclo[5.2.1.02,6]decan-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](Br)[C@@H]2C[C@H]1[C@@H]1CS(=O)(=O)C[C@@H]12 |
| InChI | InChI=1S/C11H15BrO4S/c1-5(13)16-11-7-2-6(10(11)12)8-3-17(14,15)4-9(7)8/h6-11H,2-4H2,1H3/t6-,7+,8-,9+,10-,11+/m1/s1 |
| InChIKey | BTFLTFDKXQBXLH-JXVKQMKBSA-N |
| XLogP | 0.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|