C21H28N2O — CID 10758352
2,4,6,7-tetramethyl-2-[(2-phenylethylamino)methyl]-3H-1-benzofuran-5-amine (PubChem CID 10758352) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 2,4,6,7-tetramethyl-2-[(2-phenylethylamino)methyl]-3H-1-benzofuran-5-amine.
| Compound Name | 2,4,6,7-tetramethyl-2-[(2-phenylethylamino)methyl]-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10758352 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2,4,6,7-tetramethyl-2-[(2-phenylethylamino)methyl]-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CNCCc1ccccc1)O2 |
| InChI | InChI=1S/C21H28N2O/c1-14-15(2)20-18(16(3)19(14)22)12-21(4,24-20)13-23-11-10-17-8-6-5-7-9-17/h5-9,23H,10-13,22H2,1-4H3 |
| InChIKey | SVYUWFBWBCAXED-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|