C17H28O4Si — CID 10758357
[(2R,4aS,5S,8aS)-4a-formyl-4-methylidene-5-trimethylsilyloxy-1,2,3,5,6,7,8,8a-octahydronaphthalen-2-yl] acetate (PubChem CID 10758357) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is [(2R,4aS,5S,8aS)-4a-formyl-4-methylidene-5-trimethylsilyloxy-1,2,3,5,6,7,8,8a-octahydronaphthalen-2-yl] acetate.
| Compound Name | [(2R,4aS,5S,8aS)-4a-formyl-4-methylidene-5-trimethylsilyloxy-1,2,3,5,6,7,8,8a-octahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 10758357 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | [(2R,4aS,5S,8aS)-4a-formyl-4-methylidene-5-trimethylsilyloxy-1,2,3,5,6,7,8,8a-octahydronaphthalen-2-yl] acetate |
| SMILES | C=C1C[C@H](OC(C)=O)C[C@@H]2CCC[C@H](O[Si](C)(C)C)[C@@]12C=O |
| InChI | InChI=1S/C17H28O4Si/c1-12-9-15(20-13(2)19)10-14-7-6-8-16(17(12,14)11-18)21-22(3,4)5/h11,14-16H,1,6-10H2,2-5H3/t14-,15-,16-,17-/m0/s1 |
| InChIKey | RJGBQKSUVQYQJW-QAETUUGQSA-N |
| XLogP | 3.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|