C18H24F3NO — CID 10758591
N-[(3R)-hex-1-en-3-yl]-2,2-dimethyl-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 10758591) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is N-[(3R)-hex-1-en-3-yl]-2,2-dimethyl-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-[(3R)-hex-1-en-3-yl]-2,2-dimethyl-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 10758591 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(3R)-hex-1-en-3-yl]-2,2-dimethyl-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | C=C[C@@H](CCC)N(C(=O)C(C)(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F3NO/c1-6-8-14(7-2)22(16(23)17(3,4)5)15-11-9-13(10-12-15)18(19,20)21/h7,9-12,14H,2,6,8H2,1,3-5H3/t14-/m0/s1 |
| InChIKey | UQBLLKWVEUXSQF-AWEZNQCLSA-N |
| XLogP | 5.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|