C12H15N3O3 — CID 107587535
1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]cyclopentane-1-carboxylic acid (PubChem CID 107587535) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 107587535 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 1-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CCCC1)Nc1cncnc1 |
| InChI | InChI=1S/C12H15N3O3/c16-10(15-9-6-13-8-14-7-9)5-12(11(17)18)3-1-2-4-12/h6-8H,1-5H2,(H,15,16)(H,17,18) |
| InChIKey | IHGGXIWXQNHTJQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |