C17H30O6 — CID 10758814
[(1R,2R,5R,6R)-2,5,6-trihydroxy-2-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-5-methylcyclohexyl] acetate (PubChem CID 10758814) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is [(1R,2R,5R,6R)-2,5,6-trihydroxy-2-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-5-methylcyclohexyl] acetate.
| Compound Name | [(1R,2R,5R,6R)-2,5,6-trihydroxy-2-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-5-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 10758814 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | [(1R,2R,5R,6R)-2,5,6-trihydroxy-2-[(2R)-2-hydroxy-6-methylhept-5-en-2-yl]-5-methylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@](C)(O)CC[C@]1(O)[C@](C)(O)CCC=C(C)C |
| InChI | InChI=1S/C17H30O6/c1-11(2)7-6-8-16(5,21)17(22)10-9-15(4,20)13(19)14(17)23-12(3)18/h7,13-14,19-22H,6,8-10H2,1-5H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | KNFIGEXUOBWKSE-WRQOLXDDSA-N |
| XLogP | 1.05 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|