C16H30O5Si — CID 10758839
ethyl (Z)-3-[(2S,4R)-4-hydroxy-4-(hydroxymethyl)-5,5-dimethyloxolan-2-yl]-4-trimethylsilylbut-2-enoate (PubChem CID 10758839) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is ethyl (Z)-3-[(2S,4R)-4-hydroxy-4-(hydroxymethyl)-5,5-dimethyloxolan-2-yl]-4-trimethylsilylbut-2-enoate.
| Compound Name | ethyl (Z)-3-[(2S,4R)-4-hydroxy-4-(hydroxymethyl)-5,5-dimethyloxolan-2-yl]-4-trimethylsilylbut-2-enoate |
|---|---|
| PubChem CID | 10758839 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | ethyl (Z)-3-[(2S,4R)-4-hydroxy-4-(hydroxymethyl)-5,5-dimethyloxolan-2-yl]-4-trimethylsilylbut-2-enoate |
| SMILES | CCOC(=O)/C=C(\C[Si](C)(C)C)[C@@H]1C[C@@](O)(CO)C(C)(C)O1 |
| InChI | InChI=1S/C16H30O5Si/c1-7-20-14(18)8-12(10-22(4,5)6)13-9-16(19,11-17)15(2,3)21-13/h8,13,17,19H,7,9-11H2,1-6H3/b12-8+/t13-,16+/m0/s1 |
| InChIKey | LULCAOWSQAPEBZ-RRDVCTQDSA-N |
| XLogP | 2.11 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|