C13H15ClN2O6 — CID 10758847
(1R,2S,3S,4R)-1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]pentane-1,2,3,4,5-pentol (PubChem CID 10758847) has the molecular formula C13H15ClN2O6 and a molecular weight of 330.72 g/mol. Its IUPAC name is (1R,2S,3S,4R)-1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]pentane-1,2,3,4,5-pentol.
| Compound Name | (1R,2S,3S,4R)-1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 10758847 |
| Molecular Formula | C13H15ClN2O6 |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (1R,2S,3S,4R)-1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]pentane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)c1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C13H15ClN2O6/c14-7-3-1-6(2-4-7)12-15-16-13(22-12)11(21)10(20)9(19)8(18)5-17/h1-4,8-11,17-21H,5H2/t8-,9+,10+,11-/m1/s1 |
| InChIKey | PUEPUEIIZAQMQU-VPOLOUISSA-N |
| XLogP | -0.50 |
| TPSA | 140.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |