C9H10N6O2 — CID 107588959
2-amino-3-(1-pyrimidin-5-yltriazol-4-yl)propanoic acid (PubChem CID 107588959) has the molecular formula C9H10N6O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-amino-3-(1-pyrimidin-5-yltriazol-4-yl)propanoic acid.
| Compound Name | 2-amino-3-(1-pyrimidin-5-yltriazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 107588959 |
| Molecular Formula | C9H10N6O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-amino-3-(1-pyrimidin-5-yltriazol-4-yl)propanoic acid |
| SMILES | NC(Cc1cn(-c2cncnc2)nn1)C(=O)O |
| InChI | InChI=1S/C9H10N6O2/c10-8(9(16)17)1-6-4-15(14-13-6)7-2-11-5-12-3-7/h2-5,8H,1,10H2,(H,16,17) |
| InChIKey | ZKDWHGIPUYNKLV-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |