About N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine
N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 107589103) has the molecular formula C8H10N4S
and a molecular weight of 194.26 g/mol. Its IUPAC name is N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 107589103 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | c1ncc(NC2=NCCCS2)cn1 |
| InChI | InChI=1S/C8H10N4S/c1-2-11-8(13-3-1)12-7-4-9-6-10-5-7/h4-6H,1-3H2,(H,11,12) |
| InChIKey | BEJDKAMOJIXYET-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 107589103) is N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine is c1ncc(NC2=NCCCS2)cn1.
What is the InChIKey of N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is BEJDKAMOJIXYET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S/c1-2-11-8(13-3-1)12-7-4-9-6-10-5-7/h4-6H,1-3H2,(H,11,12).
What are the key properties of N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine?
N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 194.26 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrimidin-5-yl-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 107589103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).