C14H18N4O3 — CID 107589422
2-[8-(pyrimidin-5-ylcarbamoyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid (PubChem CID 107589422) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[8-(pyrimidin-5-ylcarbamoyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid.
| Compound Name | 2-[8-(pyrimidin-5-ylcarbamoyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
|---|---|
| PubChem CID | 107589422 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[8-(pyrimidin-5-ylcarbamoyl)-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
| SMILES | O=C(O)CC1CC2CCC(C1)N2C(=O)Nc1cncnc1 |
| InChI | InChI=1S/C14H18N4O3/c19-13(20)5-9-3-11-1-2-12(4-9)18(11)14(21)17-10-6-15-8-16-7-10/h6-9,11-12H,1-5H2,(H,17,21)(H,19,20) |
| InChIKey | DVIACKWZSSNQPP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |