About 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol
4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 1075900) has the molecular formula C16H14N2O2S
and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol |
| PubChem CID | 1075900 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2csc(NCc3ccccc3)n2)cc1O |
| InChI | InChI=1S/C16H14N2O2S/c19-14-7-6-12(8-15(14)20)13-10-21-16(18-13)17-9-11-4-2-1-3-5-11/h1-8,10,19-20H,9H2,(H,17,18) |
| InChIKey | ZNBCCRUMQPZZES-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol?
The IUPAC name of 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol (CID 1075900) is 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol.
What is the SMILES notation for 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol?
The canonical SMILES for 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol is Oc1ccc(-c2csc(NCc3ccccc3)n2)cc1O.
What is the InChIKey of 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol?
The InChIKey is ZNBCCRUMQPZZES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2S/c19-14-7-6-12(8-15(14)20)13-10-21-16(18-13)17-9-11-4-2-1-3-5-11/h1-8,10,19-20H,9H2,(H,17,18).
What are the key properties of 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol?
4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol has a molecular weight of 298.37 g/mol, XLogP of 3.83, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,2-diol is sourced from PubChem (CID 1075900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).