C14H18N4O2 — CID 107590294
3-methyl-4-pyrimidin-5-yl-1,4-diazaspiro[5.5]undecane-2,5-dione (PubChem CID 107590294) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-methyl-4-pyrimidin-5-yl-1,4-diazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 3-methyl-4-pyrimidin-5-yl-1,4-diazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 107590294 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-methyl-4-pyrimidin-5-yl-1,4-diazaspiro[5.5]undecane-2,5-dione |
| SMILES | CC1C(=O)NC2(CCCCC2)C(=O)N1c1cncnc1 |
| InChI | InChI=1S/C14H18N4O2/c1-10-12(19)17-14(5-3-2-4-6-14)13(20)18(10)11-7-15-9-16-8-11/h7-10H,2-6H2,1H3,(H,17,19) |
| InChIKey | QUMVYRGJLSGYNY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |