C15H14N4O2 — CID 107590309
3-phenyl-1-pyrimidin-5-yl-1,4-diazepane-2,5-dione (PubChem CID 107590309) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-phenyl-1-pyrimidin-5-yl-1,4-diazepane-2,5-dione.
| Compound Name | 3-phenyl-1-pyrimidin-5-yl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 107590309 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-phenyl-1-pyrimidin-5-yl-1,4-diazepane-2,5-dione |
| SMILES | O=C1CCN(c2cncnc2)C(=O)C(c2ccccc2)N1 |
| InChI | InChI=1S/C15H14N4O2/c20-13-6-7-19(12-8-16-10-17-9-12)15(21)14(18-13)11-4-2-1-3-5-11/h1-5,8-10,14H,6-7H2,(H,18,20) |
| InChIKey | MLQKSIIZLVXIOY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |