C15H27NO7 — CID 10759052
(2S,3R)-3-[(1S,2R)-1,2-dihydroxy-2-[(4R,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-N,N-diethyloxirane-2-carboxamide (PubChem CID 10759052) has the molecular formula C15H27NO7 and a molecular weight of 333.38 g/mol. Its IUPAC name is (2S,3R)-3-[(1S,2R)-1,2-dihydroxy-2-[(4R,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-N,N-diethyloxirane-2-carboxamide.
| Compound Name | (2S,3R)-3-[(1S,2R)-1,2-dihydroxy-2-[(4R,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-N,N-diethyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 10759052 |
| Molecular Formula | C15H27NO7 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (2S,3R)-3-[(1S,2R)-1,2-dihydroxy-2-[(4R,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-N,N-diethyloxirane-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1O[C@@H]1[C@@H](O)[C@@H](O)[C@@H]1OC(C)(C)OC[C@H]1O |
| InChI | InChI=1S/C15H27NO7/c1-5-16(6-2)14(20)13-12(22-13)10(19)9(18)11-8(17)7-21-15(3,4)23-11/h8-13,17-19H,5-7H2,1-4H3/t8-,9-,10+,11-,12-,13+/m1/s1 |
| InChIKey | MMGPVVWEONOWCO-LYUGOTMTSA-N |
| XLogP | -1.14 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|