C14H11BrF4N2 — CID 107590972
1-N-(5-bromo-4-fluoro-2-methylphenyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 107590972) has the molecular formula C14H11BrF4N2 and a molecular weight of 363.15 g/mol. Its IUPAC name is 1-N-(5-bromo-4-fluoro-2-methylphenyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-(5-bromo-4-fluoro-2-methylphenyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 107590972 |
| Molecular Formula | C14H11BrF4N2 |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 1-N-(5-bromo-4-fluoro-2-methylphenyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Cc1cc(F)c(Br)cc1Nc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C14H11BrF4N2/c1-7-4-11(16)10(15)6-13(7)21-12-3-2-8(20)5-9(12)14(17,18)19/h2-6,21H,20H2,1H3 |
| InChIKey | BZLPLQWGHOCJID-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|