C14H16BrF4N — CID 107591458
5-bromo-4-fluoro-2-methyl-N-[3-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 107591458) has the molecular formula C14H16BrF4N and a molecular weight of 354.19 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2-methyl-N-[3-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 5-bromo-4-fluoro-2-methyl-N-[3-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 107591458 |
| Molecular Formula | C14H16BrF4N |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 5-bromo-4-fluoro-2-methyl-N-[3-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | Cc1cc(F)c(Br)cc1NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H16BrF4N/c1-8-5-12(16)11(15)7-13(8)20-10-4-2-3-9(6-10)14(17,18)19/h5,7,9-10,20H,2-4,6H2,1H3 |
| InChIKey | CKNWVVHKXQIBPA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |