C23H26O2 — CID 10759168
(8S,11R)-heptacyclo[16.2.2.18,11.02,17.04,15.06,13.07,12]tricosa-2(17),6(13)-diene-3,16-dione (PubChem CID 10759168) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (8S,11R)-heptacyclo[16.2.2.18,11.02,17.04,15.06,13.07,12]tricosa-2(17),6(13)-diene-3,16-dione.
| Compound Name | (8S,11R)-heptacyclo[16.2.2.18,11.02,17.04,15.06,13.07,12]tricosa-2(17),6(13)-diene-3,16-dione |
|---|---|
| PubChem CID | 10759168 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (8S,11R)-heptacyclo[16.2.2.18,11.02,17.04,15.06,13.07,12]tricosa-2(17),6(13)-diene-3,16-dione |
| SMILES | O=C1C2=C(C(=O)C3CC4=C(CC13)C1C4[C@H]3CC[C@@H]1C3)C1CCC2CC1 |
| InChI | InChI=1S/C23H26O2/c24-22-16-8-14-15(19-13-6-5-12(7-13)18(14)19)9-17(16)23(25)21-11-2-1-10(3-4-11)20(21)22/h10-13,16-19H,1-9H2/t10?,11?,12-,13+,16?,17?,18?,19? |
| InChIKey | LAFSJNCZMFRSOC-ACGDGCSUSA-N |
| XLogP | 4.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|