C10H12BrFN2O — CID 107592265
2-amino-N-(5-bromo-4-fluoro-2-methylphenyl)propanamide (PubChem CID 107592265) has the molecular formula C10H12BrFN2O and a molecular weight of 275.12 g/mol. Its IUPAC name is 2-amino-N-(5-bromo-4-fluoro-2-methylphenyl)propanamide.
| Compound Name | 2-amino-N-(5-bromo-4-fluoro-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 107592265 |
| Molecular Formula | C10H12BrFN2O |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 2-amino-N-(5-bromo-4-fluoro-2-methylphenyl)propanamide |
| SMILES | Cc1cc(F)c(Br)cc1NC(=O)C(C)N |
| InChI | InChI=1S/C10H12BrFN2O/c1-5-3-8(12)7(11)4-9(5)14-10(15)6(2)13/h3-4,6H,13H2,1-2H3,(H,14,15) |
| InChIKey | CRDHBBPWLZTOCY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |