C20H36O2Si — CID 10759345
(3aR,4R,5R,7aS)-5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carbaldehyde (PubChem CID 10759345) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (3aR,4R,5R,7aS)-5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carbaldehyde.
| Compound Name | (3aR,4R,5R,7aS)-5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carbaldehyde |
|---|---|
| PubChem CID | 10759345 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (3aR,4R,5R,7aS)-5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@@H]1C=C[C@@H]2CCC[C@H]2[C@@H]1C=O |
| InChI | InChI=1S/C20H36O2Si/c1-20(2,3)23(4,5)22-14-7-6-9-17-13-12-16-10-8-11-18(16)19(17)15-21/h12-13,15-19H,6-11,14H2,1-5H3/t16-,17+,18+,19+/m0/s1 |
| InChIKey | HKYVDPIRRYHIPI-WJFTUGDTSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|