C11H20BIO3 — CID 10759415
2-[(R)-iodo-[(2S)-oxolan-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 10759415) has the molecular formula C11H20BIO3 and a molecular weight of 337.99 g/mol. Its IUPAC name is 2-[(R)-iodo-[(2S)-oxolan-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(R)-iodo-[(2S)-oxolan-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10759415 |
| Molecular Formula | C11H20BIO3 |
| Molecular Weight | 337.99 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-[(R)-iodo-[(2S)-oxolan-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB([C@@H](I)[C@@H]2CCCO2)OC1(C)C |
| InChI | InChI=1S/C11H20BIO3/c1-10(2)11(3,4)16-12(15-10)9(13)8-6-5-7-14-8/h8-9H,5-7H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | ZSKNYPUTPKPWIA-IUCAKERBSA-N |
| XLogP | 2.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.99 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|