About [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate
[(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10759436) has the molecular formula C16H15FO5S
and a molecular weight of 338.36 g/mol. Its IUPAC name is [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 10759436 |
| Molecular Formula | C16H15FO5S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2COc3cccc(F)c3O2)cc1 |
| InChI | InChI=1S/C16H15FO5S/c1-11-5-7-13(8-6-11)23(18,19)21-10-12-9-20-15-4-2-3-14(17)16(15)22-12/h2-8,12H,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | XRHOOAVKNINMDW-GFCCVEGCSA-N |
| XLogP | 2.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate (CID 10759436) is [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC[C@H]2COc3cccc(F)c3O2)cc1.
What is the InChIKey of [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is XRHOOAVKNINMDW-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H15FO5S/c1-11-5-7-13(8-6-11)23(18,19)21-10-12-9-20-15-4-2-3-14(17)16(15)22-12/h2-8,12H,9-10H2,1H3/t12-/m1/s1.
What are the key properties of [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate?
[(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 338.36 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-5-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 10759436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).