C20H38O2Si — CID 10759482
(3R,3aS,9aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,2,3,4,5,6,7,8,9,9a-decahydrocyclopenta[8]annulen-3a-ol (PubChem CID 10759482) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is (3R,3aS,9aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,2,3,4,5,6,7,8,9,9a-decahydrocyclopenta[8]annulen-3a-ol.
| Compound Name | (3R,3aS,9aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,2,3,4,5,6,7,8,9,9a-decahydrocyclopenta[8]annulen-3a-ol |
|---|---|
| PubChem CID | 10759482 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (3R,3aS,9aR)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-1,2,3,4,5,6,7,8,9,9a-decahydrocyclopenta[8]annulen-3a-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/[C@H]1CC[C@H]2CCCCCC[C@]21O |
| InChI | InChI=1S/C20H38O2Si/c1-19(2,3)23(4,5)22-16-10-12-18-14-13-17-11-8-6-7-9-15-20(17,18)21/h10,12,17-18,21H,6-9,11,13-16H2,1-5H3/b12-10+/t17-,18+,20+/m1/s1 |
| InChIKey | INQKHJPFMWQDOM-FJGDOVBOSA-N |
| XLogP | 5.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|