C11H14ClN9O2 — CID 10759547
(NE)-N-[1-[(5-azido-6-chloro-3-pyridinyl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 10759547) has the molecular formula C11H14ClN9O2 and a molecular weight of 339.75 g/mol. Its IUPAC name is (NE)-N-[1-[(5-azido-6-chloro-3-pyridinyl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | (NE)-N-[1-[(5-azido-6-chloro-3-pyridinyl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 10759547 |
| Molecular Formula | C11H14ClN9O2 |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (NE)-N-[1-[(5-azido-6-chloro-3-pyridinyl)methyl]-3,5-dimethyl-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | CN1CN(C)/C(=N\[N+](=O)[O-])N(Cc2cnc(Cl)c(N=[N+]=[N-])c2)C1 |
| InChI | InChI=1S/C11H14ClN9O2/c1-18-6-19(2)11(16-21(22)23)20(7-18)5-8-3-9(15-17-13)10(12)14-4-8/h3-4H,5-7H2,1-2H3/b16-11+ |
| InChIKey | SHDXXOLWDUTGQG-LFIBNONCSA-N |
| XLogP | 1.82 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|