C8H13ClN4O2S — CID 107596039
2-chloro-5-(diethylsulfamoylamino)pyrazine (PubChem CID 107596039) has the molecular formula C8H13ClN4O2S and a molecular weight of 264.74 g/mol. Its IUPAC name is 2-chloro-5-(diethylsulfamoylamino)pyrazine.
| Compound Name | 2-chloro-5-(diethylsulfamoylamino)pyrazine |
|---|---|
| PubChem CID | 107596039 |
| Molecular Formula | C8H13ClN4O2S |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-chloro-5-(diethylsulfamoylamino)pyrazine |
| SMILES | CCN(CC)S(=O)(=O)Nc1cnc(Cl)cn1 |
| InChI | InChI=1S/C8H13ClN4O2S/c1-3-13(4-2)16(14,15)12-8-6-10-7(9)5-11-8/h5-6H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | LACUHSZDFNIAOJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |