C21H19N5 — CID 10759656
9-phenyl-2-pyridin-4-yl-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine (PubChem CID 10759656) has the molecular formula C21H19N5 and a molecular weight of 341.42 g/mol. Its IUPAC name is 9-phenyl-2-pyridin-4-yl-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine.
| Compound Name | 9-phenyl-2-pyridin-4-yl-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine |
|---|---|
| PubChem CID | 10759656 |
| Molecular Formula | C21H19N5 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 9-phenyl-2-pyridin-4-yl-5,6,7,8-tetrahydropyrimido[4,5-b]indol-4-amine |
| SMILES | Nc1nc(-c2ccncc2)nc2c1c1c(n2-c2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H19N5/c22-19-18-16-8-4-5-9-17(16)26(15-6-2-1-3-7-15)21(18)25-20(24-19)14-10-12-23-13-11-14/h1-3,6-7,10-13H,4-5,8-9H2,(H2,22,24,25) |
| InChIKey | SDJAYHMBLOZYSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |