C17H31NO4Si — CID 10759677
(4-hydroxy-6-trimethylsilylhex-5-ynyl) 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10759677) has the molecular formula C17H31NO4Si and a molecular weight of 341.52 g/mol. Its IUPAC name is (4-hydroxy-6-trimethylsilylhex-5-ynyl) 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | (4-hydroxy-6-trimethylsilylhex-5-ynyl) 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10759677 |
| Molecular Formula | C17H31NO4Si |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (4-hydroxy-6-trimethylsilylhex-5-ynyl) 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)COC(C)(C)N1C(=O)OCCCC(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H31NO4Si/c1-16(2)13-22-17(3,4)18(16)15(20)21-11-8-9-14(19)10-12-23(5,6)7/h14,19H,8-9,11,13H2,1-7H3 |
| InChIKey | FWJKMWCIFPPORU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|