C16H15Br2N — CID 107597016
2,6-dibromo-N-(3-phenylcyclobutyl)aniline (PubChem CID 107597016) has the molecular formula C16H15Br2N and a molecular weight of 381.11 g/mol. Its IUPAC name is 2,6-dibromo-N-(3-phenylcyclobutyl)aniline.
| Compound Name | 2,6-dibromo-N-(3-phenylcyclobutyl)aniline |
|---|---|
| PubChem CID | 107597016 |
| Molecular Formula | C16H15Br2N |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 2,6-dibromo-N-(3-phenylcyclobutyl)aniline |
| SMILES | Brc1cccc(Br)c1NC1CC(c2ccccc2)C1 |
| InChI | InChI=1S/C16H15Br2N/c17-14-7-4-8-15(18)16(14)19-13-9-12(10-13)11-5-2-1-3-6-11/h1-8,12-13,19H,9-10H2 |
| InChIKey | SZAVKSSSERRJQZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |